C11H15N2+ — CID 147218258
7-tert-butyl-8aH-imidazo[1,2-a]pyridin-4-ium (PubChem CID 147218258) has the molecular formula C11H15N2+ and a molecular weight of 175.25 g/mol. Its IUPAC name is 7-tert-butyl-8aH-imidazo[1,2-a]pyridin-4-ium.
| Compound Name | 7-tert-butyl-8aH-imidazo[1,2-a]pyridin-4-ium |
|---|---|
| PubChem CID | 147218258 |
| Molecular Formula | C11H15N2+ |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 7-tert-butyl-8aH-imidazo[1,2-a]pyridin-4-ium |
| SMILES | CC(C)(C)C1=CC2N=CC=[N+]2C=C1 |
| InChI | InChI=1S/C11H15N2/c1-11(2,3)9-4-6-13-7-5-12-10(13)8-9/h4-8,10H,1-3H3/q+1 |
| InChIKey | HGGGOYNAOCPQIK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|