C25H23F3N2O6S — CID 147225948
N-[2-(dihydroxymethyl)-4-[4-(trifluoromethyl)phenyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 147225948) has the molecular formula C25H23F3N2O6S and a molecular weight of 536.53 g/mol. Its IUPAC name is N-[2-(dihydroxymethyl)-4-[4-(trifluoromethyl)phenyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-(dihydroxymethyl)-4-[4-(trifluoromethyl)phenyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 147225948 |
| Molecular Formula | C25H23F3N2O6S |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | N-[2-(dihydroxymethyl)-4-[4-(trifluoromethyl)phenyl]phenyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccc(-c2ccc(C(F)(F)F)cc2)cc1C(O)O)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C25H23F3N2O6S/c26-25(27,28)19-7-4-16(5-8-19)17-6-9-22(21(15-17)24(32)33)29-23(31)18-2-1-3-20(14-18)37(34,35)30-10-12-36-13-11-30/h1-9,14-15,24,32-33H,10-13H2,(H,29,31) |
| InChIKey | CHZBNQATOJYCJY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|