C52H31N7O — CID 147229067
4-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-naphthalen-2-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 147229067) has the molecular formula C52H31N7O and a molecular weight of 769.87 g/mol. Its IUPAC name is 4-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-naphthalen-2-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-naphthalen-2-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 147229067 |
| Molecular Formula | C52H31N7O |
| Molecular Weight | 769.87 g/mol |
| Exact Mass | 769.26 |
| IUPAC Name | 4-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-naphthalen-2-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4nc(-c5ccc6ccccc6c5)c5oc6ncccc6c5n4)cc3)nc(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)n2)cc1 |
| InChI | InChI=1S/C52H31N7O/c1-2-12-33(13-3-1)49-56-50(58-51(57-49)36-26-28-39(29-27-36)59-43-18-8-6-15-40(43)41-16-7-9-19-44(41)59)35-23-21-34(22-24-35)48-54-45(38-25-20-32-11-4-5-14-37(32)31-38)47-46(55-48)42-17-10-30-53-52(42)60-47/h1-31H |
| InChIKey | CINXLSPCYCPCEU-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 95.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.87 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |