C14H12AlFN4 — CID 147231578
CID 147231578 (PubChem CID 147231578) has the molecular formula C14H12AlFN4 and a molecular weight of 282.26 g/mol.
| Compound Name | CID 147231578 |
|---|---|
| PubChem CID | 147231578 |
| Molecular Formula | C14H12AlFN4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | — |
| SMILES | CC(C)n1cnc2c(-c3ccc(F)c([Al])c3)cnnc21 |
| InChI | InChI=1S/C14H12FN4.Al/c1-9(2)19-8-16-13-12(7-17-18-14(13)19)10-3-5-11(15)6-4-10;/h3-5,7-9H,1-2H3; |
| InChIKey | LOYLEOIMYCKXQJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |