C23H39N4O3+ — CID 147245499
[2-[3-hydroxy-3-(methoxymethyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-(methanimidoyldiazenyl)azanium (PubChem CID 147245499) has the molecular formula C23H39N4O3+ and a molecular weight of 419.59 g/mol. Its IUPAC name is [2-[3-hydroxy-3-(methoxymethyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-(methanimidoyldiazenyl)azanium.
| Compound Name | [2-[3-hydroxy-3-(methoxymethyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-(methanimidoyldiazenyl)azanium |
|---|---|
| PubChem CID | 147245499 |
| Molecular Formula | C23H39N4O3+ |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | [2-[3-hydroxy-3-(methoxymethyl)-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]-(methanimidoyldiazenyl)azanium |
| SMILES | [H]/N=C/N=N/[NH2+]CC(=O)C1CCC2C3CCC4CC(O)(COC)CCC4C3CCC12C |
| InChI | InChI=1S/C23H38N4O3/c1-22-9-7-17-16-8-10-23(29,13-30-2)11-15(16)3-4-18(17)19(22)5-6-20(22)21(28)12-25-27-26-14-24/h14-20,29H,3-13H2,1-2H3,(H2,24,25,26)/p+1 |
| InChIKey | CLPSUHZYURBIBL-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|