C16H23NO4 — CID 14724754
ethyl (2S)-2-[3-[(4-methoxyphenyl)methyl]oxaziridin-2-yl]-3-methylbutanoate (PubChem CID 14724754) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is ethyl (2S)-2-[3-[(4-methoxyphenyl)methyl]oxaziridin-2-yl]-3-methylbutanoate.
| Compound Name | ethyl (2S)-2-[3-[(4-methoxyphenyl)methyl]oxaziridin-2-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 14724754 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | ethyl (2S)-2-[3-[(4-methoxyphenyl)methyl]oxaziridin-2-yl]-3-methylbutanoate |
| SMILES | CCOC(=O)[C@H](C(C)C)N1OC1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H23NO4/c1-5-20-16(18)15(11(2)3)17-14(21-17)10-12-6-8-13(19-4)9-7-12/h6-9,11,14-15H,5,10H2,1-4H3/t14?,15-,17?/m0/s1 |
| InChIKey | SZLSNPJTZLYOFU-CKDBGZEDSA-N |
| XLogP | 2.40 |
| TPSA | 51.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|