C10H13FN2O — CID 147248052
1-(5-fluoro-2-methoxy-3-pyridinyl)but-3-en-1-amine (PubChem CID 147248052) has the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxy-3-pyridinyl)but-3-en-1-amine.
| Compound Name | 1-(5-fluoro-2-methoxy-3-pyridinyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 147248052 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-(5-fluoro-2-methoxy-3-pyridinyl)but-3-en-1-amine |
| SMILES | C=CCC(N)c1cc(F)cnc1OC |
| InChI | InChI=1S/C10H13FN2O/c1-3-4-9(12)8-5-7(11)6-13-10(8)14-2/h3,5-6,9H,1,4,12H2,2H3 |
| InChIKey | CMCTWAIQDZQBOQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|