C20H34N4O6 — CID 147254146
[2-[1-[4-hydroxy-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-2-nitroprop-1-enyl]cyclopenten-1-yl]-oxidoazanium (PubChem CID 147254146) has the molecular formula C20H34N4O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is [2-[1-[4-hydroxy-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-2-nitroprop-1-enyl]cyclopenten-1-yl]-oxidoazanium.
| Compound Name | [2-[1-[4-hydroxy-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-2-nitroprop-1-enyl]cyclopenten-1-yl]-oxidoazanium |
|---|---|
| PubChem CID | 147254146 |
| Molecular Formula | C20H34N4O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | [2-[1-[4-hydroxy-3,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-2-nitroprop-1-enyl]cyclopenten-1-yl]-oxidoazanium |
| SMILES | CC(=C(C1=C([NH2+][O-])CCC1)N1CC(C)C(C)(O)C(NC(=O)OC(C)(C)C)C1)[N+](=O)[O-] |
| InChI | InChI=1S/C20H34N4O6/c1-12-10-23(11-16(20(12,6)26)21-18(25)30-19(3,4)5)17(13(2)24(28)29)14-8-7-9-15(14)22-27/h12,16,26H,7-11,22H2,1-6H3,(H,21,25) |
| InChIKey | CNGLMNHDGIDCHH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 144.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|