C12H27N2O+ — CID 147259218
[2,2,5,5-tetramethyl-3-[(propan-2-ylamino)methyl]pyrrolidin-1-yl]oxidanium (PubChem CID 147259218) has the molecular formula C12H27N2O+ and a molecular weight of 215.36 g/mol. Its IUPAC name is [2,2,5,5-tetramethyl-3-[(propan-2-ylamino)methyl]pyrrolidin-1-yl]oxidanium.
| Compound Name | [2,2,5,5-tetramethyl-3-[(propan-2-ylamino)methyl]pyrrolidin-1-yl]oxidanium |
|---|---|
| PubChem CID | 147259218 |
| Molecular Formula | C12H27N2O+ |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.21 |
| IUPAC Name | [2,2,5,5-tetramethyl-3-[(propan-2-ylamino)methyl]pyrrolidin-1-yl]oxidanium |
| SMILES | CC(C)NCC1CC(C)(C)N([OH2+])C1(C)C |
| InChI | InChI=1S/C12H26N2O/c1-9(2)13-8-10-7-11(3,4)14(15)12(10,5)6/h9-10,13,15H,7-8H2,1-6H3/p+1 |
| InChIKey | COFODLOEZINHNT-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 38.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|