C17H21Cl2N5O — CID 14726267
4-chloro-5-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethylamino]-2-methylpyridazin-3-one (PubChem CID 14726267) has the molecular formula C17H21Cl2N5O and a molecular weight of 382.30 g/mol. Its IUPAC name is 4-chloro-5-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethylamino]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethylamino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 14726267 |
| Molecular Formula | C17H21Cl2N5O |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-chloro-5-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethylamino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NCCN2CCN(c3cccc(Cl)c3)CC2)c(Cl)c1=O |
| InChI | InChI=1S/C17H21Cl2N5O/c1-22-17(25)16(19)15(12-21-22)20-5-6-23-7-9-24(10-8-23)14-4-2-3-13(18)11-14/h2-4,11-12,20H,5-10H2,1H3 |
| InChIKey | LMHZRBMNIHUGEY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |