C21H30ClN5O2 — CID 14726283
2-tert-butyl-4-chloro-5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylamino]pyridazin-3-one (PubChem CID 14726283) has the molecular formula C21H30ClN5O2 and a molecular weight of 419.96 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylamino]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 14726283 |
| Molecular Formula | C21H30ClN5O2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylamino]pyridazin-3-one |
| SMILES | COc1ccccc1N1CCN(CCNc2cnn(C(C)(C)C)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C21H30ClN5O2/c1-21(2,3)27-20(28)19(22)16(15-24-27)23-9-10-25-11-13-26(14-12-25)17-7-5-6-8-18(17)29-4/h5-8,15,23H,9-14H2,1-4H3 |
| InChIKey | DDGFVUPKVOLLJP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |