C18H24ClN5O2 — CID 14726215
5-chloro-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylamino]-2-methylpyridazin-3-one (PubChem CID 14726215) has the molecular formula C18H24ClN5O2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 5-chloro-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylamino]-2-methylpyridazin-3-one.
| Compound Name | 5-chloro-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylamino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 14726215 |
| Molecular Formula | C18H24ClN5O2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 5-chloro-4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethylamino]-2-methylpyridazin-3-one |
| SMILES | COc1ccccc1N1CCN(CCNc2c(Cl)cnn(C)c2=O)CC1 |
| InChI | InChI=1S/C18H24ClN5O2/c1-22-18(25)17(14(19)13-21-22)20-7-8-23-9-11-24(12-10-23)15-5-3-4-6-16(15)26-2/h3-6,13,20H,7-12H2,1-2H3 |
| InChIKey | KGHUNJFPNBDMSJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |