C19H22N3O+ — CID 147262789
(1-amino-2-cyclopropylpyridin-1-ium-4-yl)-[(1R)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 147262789) has the molecular formula C19H22N3O+ and a molecular weight of 308.40 g/mol. Its IUPAC name is (1-amino-2-cyclopropylpyridin-1-ium-4-yl)-[(1R)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | (1-amino-2-cyclopropylpyridin-1-ium-4-yl)-[(1R)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 147262789 |
| Molecular Formula | C19H22N3O+ |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (1-amino-2-cyclopropylpyridin-1-ium-4-yl)-[(1R)-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | C[C@@H]1c2ccccc2CCN1C(=O)c1cc[n+](N)c(C2CC2)c1 |
| InChI | InChI=1S/C19H21N3O/c1-13-17-5-3-2-4-14(17)8-10-21(13)19(23)16-9-11-22(20)18(12-16)15-6-7-15/h2-5,9,11-13,15H,6-8,10H2,1H3,(H-,20,23)/p+1/t13-/m1/s1 |
| InChIKey | COWVYKSCCOHLEU-CYBMUJFWSA-O |
| XLogP | 2.32 |
| TPSA | 50.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|