About (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone
(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone (PubChem CID 166312922) has the molecular formula C19H19N5O
and a molecular weight of 333.40 g/mol. Its IUPAC name is (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone.
Molecular Properties
| Compound Name | (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone |
| PubChem CID | 166312922 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone |
| SMILES | CC1c2ccccc2CCN1C(=O)c1cccc(Cc2nn[nH]n2)c1 |
| InChI | InChI=1S/C19H19N5O/c1-13-17-8-3-2-6-15(17)9-10-24(13)19(25)16-7-4-5-14(11-16)12-18-20-22-23-21-18/h2-8,11,13H,9-10,12H2,1H3,(H,20,21,22,23) |
| InChIKey | PUJYRSCANXDLJP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone?
The IUPAC name of (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone (CID 166312922) is (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone.
What is the SMILES notation for (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone?
The canonical SMILES for (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone is CC1c2ccccc2CCN1C(=O)c1cccc(Cc2nn[nH]n2)c1.
What is the InChIKey of (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone?
The InChIKey is PUJYRSCANXDLJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O/c1-13-17-8-3-2-6-15(17)9-10-24(13)19(25)16-7-4-5-14(11-16)12-18-20-22-23-21-18/h2-8,11,13H,9-10,12H2,1H3,(H,20,21,22,23).
What are the key properties of (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone?
(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone has a molecular weight of 333.40 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-[3-(2H-tetrazol-5-ylmethyl)phenyl]methanone is sourced from PubChem (CID 166312922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).