C21H22O2 — CID 147264613
(2S)-2-methyl-1-(4-phenylmethoxyphenyl)hept-6-yn-3-one (PubChem CID 147264613) has the molecular formula C21H22O2 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2S)-2-methyl-1-(4-phenylmethoxyphenyl)hept-6-yn-3-one.
| Compound Name | (2S)-2-methyl-1-(4-phenylmethoxyphenyl)hept-6-yn-3-one |
|---|---|
| PubChem CID | 147264613 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2S)-2-methyl-1-(4-phenylmethoxyphenyl)hept-6-yn-3-one |
| SMILES | C#CCCC(=O)[C@@H](C)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H22O2/c1-3-4-10-21(22)17(2)15-18-11-13-20(14-12-18)23-16-19-8-6-5-7-9-19/h1,5-9,11-14,17H,4,10,15-16H2,2H3/t17-/m0/s1 |
| InChIKey | CPFUHEFWCDBNNH-KRWDZBQOSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|