C22H30N7O14P2+ — CID 147267800
[[(2R,3R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 147267800) has the molecular formula C22H30N7O14P2+ and a molecular weight of 678.46 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 147267800 |
| Molecular Formula | C22H30N7O14P2+ |
| Molecular Weight | 678.46 g/mol |
| Exact Mass | 678.13 |
| IUPAC Name | [[(2R,3R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Cc1nc2c(N)ncnc2n1[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H]([n+]3cccc(C(N)=O)c3)C(O)C2O)[C@H](O)C1O |
| InChI | InChI=1S/C22H29N7O14P2/c1-9-27-13-18(23)25-8-26-20(13)29(9)22-17(33)15(31)12(42-22)7-40-45(37,38)43-44(35,36)39-6-11-14(30)16(32)21(41-11)28-4-2-3-10(5-28)19(24)34/h2-5,8,11-12,14-17,21-22,30-33H,6-7H2,1H3,(H5-,23,24,25,26,34,35,36,37,38)/p+1/t11-,12-,14?,15+,16?,17?,21-,22-/m1/s1 |
| InChIKey | OROQQXHZPUFGAS-QBSUYFIASA-O |
| XLogP | -2.71 |
| TPSA | 318.26 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.46 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|