C21H29N8O13P2+ — CID 24822417
[[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,5R)-5-(6,8-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 24822417) has the molecular formula C21H29N8O13P2+ and a molecular weight of 663.45 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,5R)-5-(6,8-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,5R)-5-(6,8-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 24822417 |
| Molecular Formula | C21H29N8O13P2+ |
| Molecular Weight | 663.45 g/mol |
| Exact Mass | 663.13 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,5R)-5-(6,8-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4c(N)nc5c(N)ncnc54)C[C@@H]3O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C21H28N8O13P2/c22-17-14-19(26-8-25-17)29(21(24)27-14)13-4-10(30)11(40-13)6-38-43(34,35)42-44(36,37)39-7-12-15(31)16(32)20(41-12)28-3-1-2-9(5-28)18(23)33/h1-3,5,8,10-13,15-16,20,30-32H,4,6-7H2,(H7-,22,23,24,25,26,27,33,34,35,36,37)/p+1/t10-,11+,12+,13+,15+,16+,20+/m0/s1 |
| InChIKey | JHSOTMZIYZBXSW-FZQXZCJRSA-O |
| XLogP | -2.40 |
| TPSA | 324.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.45 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|