C34H21IN2O — CID 147270848
4-dibenzofuran-1-yl-2-(3,5-diphenylphenyl)-6-iodopyrimidine (PubChem CID 147270848) has the molecular formula C34H21IN2O and a molecular weight of 600.46 g/mol. Its IUPAC name is 4-dibenzofuran-1-yl-2-(3,5-diphenylphenyl)-6-iodopyrimidine.
| Compound Name | 4-dibenzofuran-1-yl-2-(3,5-diphenylphenyl)-6-iodopyrimidine |
|---|---|
| PubChem CID | 147270848 |
| Molecular Formula | C34H21IN2O |
| Molecular Weight | 600.46 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | 4-dibenzofuran-1-yl-2-(3,5-diphenylphenyl)-6-iodopyrimidine |
| SMILES | Ic1cc(-c2cccc3oc4ccccc4c23)nc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C34H21IN2O/c35-32-21-29(27-15-9-17-31-33(27)28-14-7-8-16-30(28)38-31)36-34(37-32)26-19-24(22-10-3-1-4-11-22)18-25(20-26)23-12-5-2-6-13-23/h1-21H |
| InChIKey | CQJPYLJDIAYSMJ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.46 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|