C20H19ClN2O3 — CID 147280943
[4-chloro-3-cyano-6-[(4S)-2-oxo-4-phenylpentyl]-2-pyridinyl]methyl acetate (PubChem CID 147280943) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is [4-chloro-3-cyano-6-[(4S)-2-oxo-4-phenylpentyl]-2-pyridinyl]methyl acetate.
| Compound Name | [4-chloro-3-cyano-6-[(4S)-2-oxo-4-phenylpentyl]-2-pyridinyl]methyl acetate |
|---|---|
| PubChem CID | 147280943 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [4-chloro-3-cyano-6-[(4S)-2-oxo-4-phenylpentyl]-2-pyridinyl]methyl acetate |
| SMILES | CC(=O)OCc1nc(CC(=O)C[C@H](C)c2ccccc2)cc(Cl)c1C#N |
| InChI | InChI=1S/C20H19ClN2O3/c1-13(15-6-4-3-5-7-15)8-17(25)9-16-10-19(21)18(11-22)20(23-16)12-26-14(2)24/h3-7,10,13H,8-9,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | CSHDFHMMJFVTHR-ZDUSSCGKSA-N |
| XLogP | 3.98 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |