C15H15FIN5O2S — CID 147289622
4-[4-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl)butyl]-3-fluoro-N-iodothiophene-2-carboxamide (PubChem CID 147289622) has the molecular formula C15H15FIN5O2S and a molecular weight of 475.29 g/mol. Its IUPAC name is 4-[4-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl)butyl]-3-fluoro-N-iodothiophene-2-carboxamide.
| Compound Name | 4-[4-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl)butyl]-3-fluoro-N-iodothiophene-2-carboxamide |
|---|---|
| PubChem CID | 147289622 |
| Molecular Formula | C15H15FIN5O2S |
| Molecular Weight | 475.29 g/mol |
| Exact Mass | 475.00 |
| IUPAC Name | 4-[4-(2-amino-4-oxo-3,7-dihydropyrrolo[2,3-d]pyrimidin-6-yl)butyl]-3-fluoro-N-iodothiophene-2-carboxamide |
| SMILES | Nc1nc2[nH]c(CCCCc3csc(C(=O)NI)c3F)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H15FIN5O2S/c16-10-7(6-25-11(10)14(24)22-17)3-1-2-4-8-5-9-12(19-8)20-15(18)21-13(9)23/h5-6H,1-4H2,(H,22,24)(H4,18,19,20,21,23) |
| InChIKey | CTXOXZZAXQXJCF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|