C23H24N2O5 — CID 147290579
2-phenyl-4-[3-(3,4,5-trimethoxyphenyl)butanoyl]-1H-pyrimidin-6-one (PubChem CID 147290579) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-phenyl-4-[3-(3,4,5-trimethoxyphenyl)butanoyl]-1H-pyrimidin-6-one.
| Compound Name | 2-phenyl-4-[3-(3,4,5-trimethoxyphenyl)butanoyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 147290579 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-phenyl-4-[3-(3,4,5-trimethoxyphenyl)butanoyl]-1H-pyrimidin-6-one |
| SMILES | COc1cc(C(C)CC(=O)c2cc(=O)[nH]c(-c3ccccc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N2O5/c1-14(16-11-19(28-2)22(30-4)20(12-16)29-3)10-18(26)17-13-21(27)25-23(24-17)15-8-6-5-7-9-15/h5-9,11-14H,10H2,1-4H3,(H,24,25,27) |
| InChIKey | CUCMJUZSTZBBFQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |