C34H30I3O5S+ — CID 147290584
[4-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]phenyl]-phenyl-[4-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium (PubChem CID 147290584) has the molecular formula C34H30I3O5S+ and a molecular weight of 931.39 g/mol. Its IUPAC name is [4-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]phenyl]-phenyl-[4-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium.
| Compound Name | [4-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]phenyl]-phenyl-[4-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium |
|---|---|
| PubChem CID | 147290584 |
| Molecular Formula | C34H30I3O5S+ |
| Molecular Weight | 931.39 g/mol |
| Exact Mass | 930.89 |
| IUPAC Name | [4-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]phenyl]-phenyl-[4-(2,3,6-triiodobenzoyl)oxyphenyl]sulfanium |
| SMILES | CC1(OC(=O)COc2ccc([S+](c3ccccc3)c3ccc(OC(=O)c4c(I)ccc(I)c4I)cc3)cc2)CCCCC1 |
| InChI | InChI=1S/C34H30I3O5S/c1-34(20-6-3-7-21-34)42-30(38)22-40-23-10-14-26(15-11-23)43(25-8-4-2-5-9-25)27-16-12-24(13-17-27)41-33(39)31-28(35)18-19-29(36)32(31)37/h2,4-5,8-19H,3,6-7,20-22H2,1H3/q+1 |
| InChIKey | CUCMNYHQFAVQMP-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.39 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|