C32H30F5O3S+ — CID 158176919
[4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;1,1,1,3,3-pentafluoropropan-2-yl benzoate (PubChem CID 158176919) has the molecular formula C32H30F5O3S+ and a molecular weight of 589.65 g/mol. Its IUPAC name is [4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;1,1,1,3,3-pentafluoropropan-2-yl benzoate.
| Compound Name | [4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;1,1,1,3,3-pentafluoropropan-2-yl benzoate |
|---|---|
| PubChem CID | 158176919 |
| Molecular Formula | C32H30F5O3S+ |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | [4-[(2-methylpropan-2-yl)oxy]phenyl]-diphenylsulfanium;1,1,1,3,3-pentafluoropropan-2-yl benzoate |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=C(OC(C(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H23OS.C10H7F5O2/c1-22(2,3)23-18-14-16-21(17-15-18)24(19-10-6-4-7-11-19)20-12-8-5-9-13-20;11-8(12)7(10(13,14)15)17-9(16)6-4-2-1-3-5-6/h4-17H,1-3H3;1-5,7-8H/q+1; |
| InChIKey | FYCNUFZMNQLLBD-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|