C11H20O2 — CID 14729907
2-methyl-1,12-dioxaspiro[5.6]dodecane (PubChem CID 14729907) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-methyl-1,12-dioxaspiro[5.6]dodecane.
| Compound Name | 2-methyl-1,12-dioxaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 14729907 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-methyl-1,12-dioxaspiro[5.6]dodecane |
| SMILES | CC1CCCC2(CCCCCO2)O1 |
| InChI | InChI=1S/C11H20O2/c1-10-6-5-8-11(13-10)7-3-2-4-9-12-11/h10H,2-9H2,1H3 |
| InChIKey | WLQFFPNTGKKCAI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |