C30H37ClN6O4 — CID 147302071
2-[2-[2-chloro-5-[(2R)-2-hydroxypentoxy]phenyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylpyrimidin-4-yl]-N,N-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 147302071) has the molecular formula C30H37ClN6O4 and a molecular weight of 581.12 g/mol. Its IUPAC name is 2-[2-[2-chloro-5-[(2R)-2-hydroxypentoxy]phenyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylpyrimidin-4-yl]-N,N-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | 2-[2-[2-chloro-5-[(2R)-2-hydroxypentoxy]phenyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylpyrimidin-4-yl]-N,N-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 147302071 |
| Molecular Formula | C30H37ClN6O4 |
| Molecular Weight | 581.12 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 2-[2-[2-chloro-5-[(2R)-2-hydroxypentoxy]phenyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylpyrimidin-4-yl]-N,N-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CCC[C@@H](O)COc1ccc(Cl)c(-c2nc(-c3c(C)noc3C)c(C)c(N3CC4=C(CN(C(=O)N(C)C)C4)C3)n2)c1 |
| InChI | InChI=1S/C30H37ClN6O4/c1-7-8-22(38)16-40-23-9-10-25(31)24(11-23)28-32-27(26-18(3)34-41-19(26)4)17(2)29(33-28)36-12-20-14-37(15-21(20)13-36)30(39)35(5)6/h9-11,22,38H,7-8,12-16H2,1-6H3/t22-/m1/s1 |
| InChIKey | CWHCREJGCXYDHX-JOCHJYFZSA-N |
| XLogP | 5.03 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.12 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|