C29H36ClN6O3+ — CID 159779556
(2R)-1-[4-chloro-3-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methyl-6-(1,2,3-trimethyl-4,6-dihydropyrrolo[3,4-c]pyrazol-1-ium-5-yl)pyrimidin-2-yl]phenoxy]pentan-2-ol (PubChem CID 159779556) has the molecular formula C29H36ClN6O3+ and a molecular weight of 552.10 g/mol. Its IUPAC name is (2R)-1-[4-chloro-3-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methyl-6-(1,2,3-trimethyl-4,6-dihydropyrrolo[3,4-c]pyrazol-1-ium-5-yl)pyrimidin-2-yl]phenoxy]pentan-2-ol.
| Compound Name | (2R)-1-[4-chloro-3-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methyl-6-(1,2,3-trimethyl-4,6-dihydropyrrolo[3,4-c]pyrazol-1-ium-5-yl)pyrimidin-2-yl]phenoxy]pentan-2-ol |
|---|---|
| PubChem CID | 159779556 |
| Molecular Formula | C29H36ClN6O3+ |
| Molecular Weight | 552.10 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | (2R)-1-[4-chloro-3-[4-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methyl-6-(1,2,3-trimethyl-4,6-dihydropyrrolo[3,4-c]pyrazol-1-ium-5-yl)pyrimidin-2-yl]phenoxy]pentan-2-ol |
| SMILES | CCC[C@@H](O)COc1ccc(Cl)c(-c2nc(-c3c(C)noc3C)c(C)c(N3Cc4c(C)n(C)[n+](C)c4C3)n2)c1 |
| InChI | InChI=1S/C29H36ClN6O3/c1-8-9-20(37)15-38-21-10-11-24(30)22(12-21)28-31-27(26-17(3)33-39-19(26)5)16(2)29(32-28)36-13-23-18(4)34(6)35(7)25(23)14-36/h10-12,20,37H,8-9,13-15H2,1-7H3/q+1/t20-/m1/s1 |
| InChIKey | GZYROAGXOMMJIZ-HXUWFJFHSA-N |
| XLogP | 4.91 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.10 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|