C23H24N8O — CID 147303089
6-[5-[6-(2-cyclobutylethyl)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 147303089) has the molecular formula C23H24N8O and a molecular weight of 428.50 g/mol. Its IUPAC name is 6-[5-[6-(2-cyclobutylethyl)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[5-[6-(2-cyclobutylethyl)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 147303089 |
| Molecular Formula | C23H24N8O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 6-[5-[6-(2-cyclobutylethyl)-3-pyridinyl]-1,2,4-oxadiazol-3-yl]-2-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(c1ccccc1)c1nc(N)nc(-c2noc(-c3ccc(CCC4CCC4)nc3)n2)n1 |
| InChI | InChI=1S/C23H24N8O/c1-31(18-8-3-2-4-9-18)23-28-19(27-22(24)29-23)20-26-21(32-30-20)16-11-13-17(25-14-16)12-10-15-6-5-7-15/h2-4,8-9,11,13-15H,5-7,10,12H2,1H3,(H2,24,27,28,29) |
| InChIKey | CWMALHFHRDAYKY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |