About (2R)-2-(2,2-dibromoethenyl)pyrrolidine
(2R)-2-(2,2-dibromoethenyl)pyrrolidine (PubChem CID 14730329) has the molecular formula C6H9Br2N
and a molecular weight of 254.95 g/mol. Its IUPAC name is (2R)-2-(2,2-dibromoethenyl)pyrrolidine.
Molecular Properties
| Compound Name | (2R)-2-(2,2-dibromoethenyl)pyrrolidine |
| PubChem CID | 14730329 |
| Molecular Formula | C6H9Br2N |
| Molecular Weight | 254.95 g/mol |
| Exact Mass | 252.91 |
| IUPAC Name | (2R)-2-(2,2-dibromoethenyl)pyrrolidine |
| SMILES | BrC(Br)=C[C@H]1CCCN1 |
| InChI | InChI=1S/C6H9Br2N/c7-6(8)4-5-2-1-3-9-5/h4-5,9H,1-3H2/t5-/m1/s1 |
| InChIKey | VYAUFRHIMFDTSN-RXMQYKEDSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.95 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-(2,2-dibromoethenyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2,2-dibromoethenyl)pyrrolidine?
The IUPAC name of (2R)-2-(2,2-dibromoethenyl)pyrrolidine (CID 14730329) is (2R)-2-(2,2-dibromoethenyl)pyrrolidine.
What is the SMILES notation for (2R)-2-(2,2-dibromoethenyl)pyrrolidine?
The canonical SMILES for (2R)-2-(2,2-dibromoethenyl)pyrrolidine is BrC(Br)=C[C@H]1CCCN1.
What is the InChIKey of (2R)-2-(2,2-dibromoethenyl)pyrrolidine?
The InChIKey is VYAUFRHIMFDTSN-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H9Br2N/c7-6(8)4-5-2-1-3-9-5/h4-5,9H,1-3H2/t5-/m1/s1.
What are the key properties of (2R)-2-(2,2-dibromoethenyl)pyrrolidine?
(2R)-2-(2,2-dibromoethenyl)pyrrolidine has a molecular weight of 254.95 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,2-dibromoethenyl)pyrrolidine is sourced from PubChem (CID 14730329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).