C24H23N5O3 — CID 147310764
6-(3H-isoindol-5-yl)-N-[3-methoxy-4-(2-methoxyethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 147310764) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 6-(3H-isoindol-5-yl)-N-[3-methoxy-4-(2-methoxyethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(3H-isoindol-5-yl)-N-[3-methoxy-4-(2-methoxyethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 147310764 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 6-(3H-isoindol-5-yl)-N-[3-methoxy-4-(2-methoxyethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | COCCOc1ccc(Nc2nc(-c3ccc4c(c3)CN=C4)cn3ccnc23)cc1OC |
| InChI | InChI=1S/C24H23N5O3/c1-30-9-10-32-21-6-5-19(12-22(21)31-2)27-23-24-26-7-8-29(24)15-20(28-23)16-3-4-17-13-25-14-18(17)11-16/h3-8,11-13,15H,9-10,14H2,1-2H3,(H,27,28) |
| InChIKey | CXXFVILZRQAPEG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|