C24H23N7 — CID 147798212
6-(3H-isoindol-5-yl)-N-(4-piperazin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 147798212) has the molecular formula C24H23N7 and a molecular weight of 409.50 g/mol. Its IUPAC name is 6-(3H-isoindol-5-yl)-N-(4-piperazin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(3H-isoindol-5-yl)-N-(4-piperazin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 147798212 |
| Molecular Formula | C24H23N7 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 6-(3H-isoindol-5-yl)-N-(4-piperazin-1-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | C1=NCc2cc(-c3cn4ccnc4c(Nc4ccc(N5CCNCC5)cc4)n3)ccc21 |
| InChI | InChI=1S/C24H23N7/c1-2-18-14-26-15-19(18)13-17(1)22-16-31-12-9-27-24(31)23(29-22)28-20-3-5-21(6-4-20)30-10-7-25-8-11-30/h1-6,9,12-14,16,25H,7-8,10-11,15H2,(H,28,29) |
| InChIKey | HKZLWUHAVBZVFX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|