C29H30N8O3 — CID 159621291
N-hydroxy-5-[4-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperazin-1-yl]-5-oxopentanamide (PubChem CID 159621291) has the molecular formula C29H30N8O3 and a molecular weight of 538.61 g/mol. Its IUPAC name is N-hydroxy-5-[4-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperazin-1-yl]-5-oxopentanamide.
| Compound Name | N-hydroxy-5-[4-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperazin-1-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 159621291 |
| Molecular Formula | C29H30N8O3 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | N-hydroxy-5-[4-[4-[[6-(3H-isoindol-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]phenyl]piperazin-1-yl]-5-oxopentanamide |
| SMILES | O=C(CCCC(=O)N1CCN(c2ccc(Nc3nc(-c4ccc5c(c4)CN=C5)cn4ccnc34)cc2)CC1)NO |
| InChI | InChI=1S/C29H30N8O3/c38-26(34-40)2-1-3-27(39)36-14-12-35(13-15-36)24-8-6-23(7-9-24)32-28-29-31-10-11-37(29)19-25(33-28)20-4-5-21-17-30-18-22(21)16-20/h4-11,16-17,19,40H,1-3,12-15,18H2,(H,32,33)(H,34,38) |
| InChIKey | SLDDZINGHVBHMX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|