C27H30N8O2 — CID 142373520
N-hydroxy-7-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]heptanamide (PubChem CID 142373520) has the molecular formula C27H30N8O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is N-hydroxy-7-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]heptanamide.
| Compound Name | N-hydroxy-7-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]heptanamide |
|---|---|
| PubChem CID | 142373520 |
| Molecular Formula | C27H30N8O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | N-hydroxy-7-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]heptanamide |
| SMILES | CN(CCCCCCC(=O)NO)c1ccc(Nc2nc(-c3ccc4cn[nH]c4c3)cn3ccnc23)cc1 |
| InChI | InChI=1S/C27H30N8O2/c1-34(14-5-3-2-4-6-25(36)33-37)22-11-9-21(10-12-22)30-26-27-28-13-15-35(27)18-24(31-26)19-7-8-20-17-29-32-23(20)16-19/h7-13,15-18,37H,2-6,14H2,1H3,(H,29,32)(H,30,31)(H,33,36) |
| InChIKey | HUSPOANRUXUJCF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 123.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|