C24H22N6O3 — CID 153207771
6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-4H-pyrano[2,3-b]pyridin-3-one (PubChem CID 153207771) has the molecular formula C24H22N6O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is 6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-4H-pyrano[2,3-b]pyridin-3-one.
| Compound Name | 6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-4H-pyrano[2,3-b]pyridin-3-one |
|---|---|
| PubChem CID | 153207771 |
| Molecular Formula | C24H22N6O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-4H-pyrano[2,3-b]pyridin-3-one |
| SMILES | O=C1COc2ncc(-c3cn4ccnc4c(Nc4ccc(N5CCOCC5)cc4)n3)cc2C1 |
| InChI | InChI=1S/C24H22N6O3/c31-20-12-16-11-17(13-26-24(16)33-15-20)21-14-30-6-5-25-23(30)22(28-21)27-18-1-3-19(4-2-18)29-7-9-32-10-8-29/h1-6,11,13-14H,7-10,12,15H2,(H,27,28) |
| InChIKey | WLEDSTPESJCRPD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|