C24H24N6O2 — CID 153061267
6-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-7-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 153061267) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-7-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-7-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 153061267 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 6-(3,4-dihydro-2H-pyrano[2,3-b]pyridin-7-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | c1cn2cc(-c3ccc4c(n3)OCCC4)nc(Nc3ccc(N4CCOCC4)cc3)c2n1 |
| InChI | InChI=1S/C24H24N6O2/c1-2-17-3-8-20(28-24(17)32-13-1)21-16-30-10-9-25-23(30)22(27-21)26-18-4-6-19(7-5-18)29-11-14-31-15-12-29/h3-10,16H,1-2,11-15H2,(H,26,27) |
| InChIKey | VJMKCLZUJNFMGO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|