C29H24N6O2S — CID 153030530
(3E)-6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3-(1,3-thiazol-4-ylmethylidene)-1H-inden-2-one (PubChem CID 153030530) has the molecular formula C29H24N6O2S and a molecular weight of 520.62 g/mol. Its IUPAC name is (3E)-6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3-(1,3-thiazol-4-ylmethylidene)-1H-inden-2-one.
| Compound Name | (3E)-6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3-(1,3-thiazol-4-ylmethylidene)-1H-inden-2-one |
|---|---|
| PubChem CID | 153030530 |
| Molecular Formula | C29H24N6O2S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (3E)-6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-3-(1,3-thiazol-4-ylmethylidene)-1H-inden-2-one |
| SMILES | O=C1Cc2cc(-c3cn4ccnc4c(Nc4ccc(N5CCOCC5)cc4)n3)ccc2/C1=C\c1cscn1 |
| InChI | InChI=1S/C29H24N6O2S/c36-27-14-20-13-19(1-6-24(20)25(27)15-22-17-38-18-31-22)26-16-35-8-7-30-29(35)28(33-26)32-21-2-4-23(5-3-21)34-9-11-37-12-10-34/h1-8,13,15-18H,9-12,14H2,(H,32,33)/b25-15+ |
| InChIKey | VDSJZWOVGUSROA-MFKUBSTISA-N |
| XLogP | 5.10 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|