C26H25N5O3 — CID 158668845
(3S)-3-hydroxy-3-methyl-6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-1H-inden-2-one (PubChem CID 158668845) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is (3S)-3-hydroxy-3-methyl-6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-1H-inden-2-one.
| Compound Name | (3S)-3-hydroxy-3-methyl-6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-1H-inden-2-one |
|---|---|
| PubChem CID | 158668845 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | (3S)-3-hydroxy-3-methyl-6-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]-1H-inden-2-one |
| SMILES | C[C@@]1(O)C(=O)Cc2cc(-c3cn4ccnc4c(Nc4ccc(N5CCOCC5)cc4)n3)ccc21 |
| InChI | InChI=1S/C26H25N5O3/c1-26(33)21-7-2-17(14-18(21)15-23(26)32)22-16-31-9-8-27-25(31)24(29-22)28-19-3-5-20(6-4-19)30-10-12-34-13-11-30/h2-9,14,16,33H,10-13,15H2,1H3,(H,28,29)/t26-/m0/s1 |
| InChIKey | IDRWDZUURUCHIK-SANMLTNESA-N |
| XLogP | 3.31 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|