C27H29N5O2 — CID 147107388
6-[8-[4-[ethyl(2-hydroxyethyl)amino]anilino]imidazo[1,2-a]pyrazin-6-yl]-3,3-dimethyl-1H-inden-2-one (PubChem CID 147107388) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 6-[8-[4-[ethyl(2-hydroxyethyl)amino]anilino]imidazo[1,2-a]pyrazin-6-yl]-3,3-dimethyl-1H-inden-2-one.
| Compound Name | 6-[8-[4-[ethyl(2-hydroxyethyl)amino]anilino]imidazo[1,2-a]pyrazin-6-yl]-3,3-dimethyl-1H-inden-2-one |
|---|---|
| PubChem CID | 147107388 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 6-[8-[4-[ethyl(2-hydroxyethyl)amino]anilino]imidazo[1,2-a]pyrazin-6-yl]-3,3-dimethyl-1H-inden-2-one |
| SMILES | CCN(CCO)c1ccc(Nc2nc(-c3ccc4c(c3)CC(=O)C4(C)C)cn3ccnc23)cc1 |
| InChI | InChI=1S/C27H29N5O2/c1-4-31(13-14-33)21-8-6-20(7-9-21)29-25-26-28-11-12-32(26)17-23(30-25)18-5-10-22-19(15-18)16-24(34)27(22,2)3/h5-12,15,17,33H,4,13-14,16H2,1-3H3,(H,29,30) |
| InChIKey | BLVGPHVLHCNHME-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|