C28H29F3N4O2 — CID 147320237
1-[3-[7-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one (PubChem CID 147320237) has the molecular formula C28H29F3N4O2 and a molecular weight of 510.56 g/mol. Its IUPAC name is 1-[3-[7-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one.
| Compound Name | 1-[3-[7-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 147320237 |
| Molecular Formula | C28H29F3N4O2 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 1-[3-[7-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-5,5,5-trifluoropentan-2-one |
| SMILES | CN(C)CCCOc1ccc(-c2ccn3c(-c4cccc(CC(=O)CCC(F)(F)F)c4)cnc3c2)cn1 |
| InChI | InChI=1S/C28H29F3N4O2/c1-34(2)12-4-14-37-27-8-7-23(18-33-27)21-10-13-35-25(19-32-26(35)17-21)22-6-3-5-20(15-22)16-24(36)9-11-28(29,30)31/h3,5-8,10,13,15,17-19H,4,9,11-12,14,16H2,1-2H3 |
| InChIKey | CZQQEYGLNZWVDP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|