C26H28N4O — CID 147323094
5-amino-12-(4-cyanophenyl)-N,N-dipropyl-2-azatricyclo[7.4.0.02,4]trideca-1(9),4,7,10,12-pentaene-7-carboxamide (PubChem CID 147323094) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 5-amino-12-(4-cyanophenyl)-N,N-dipropyl-2-azatricyclo[7.4.0.02,4]trideca-1(9),4,7,10,12-pentaene-7-carboxamide.
| Compound Name | 5-amino-12-(4-cyanophenyl)-N,N-dipropyl-2-azatricyclo[7.4.0.02,4]trideca-1(9),4,7,10,12-pentaene-7-carboxamide |
|---|---|
| PubChem CID | 147323094 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 5-amino-12-(4-cyanophenyl)-N,N-dipropyl-2-azatricyclo[7.4.0.02,4]trideca-1(9),4,7,10,12-pentaene-7-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(-c3ccc(C#N)cc3)cc2N2CC2=C(N)C1 |
| InChI | InChI=1S/C26H28N4O/c1-3-11-29(12-4-2)26(31)22-13-21-10-9-20(19-7-5-18(16-27)6-8-19)15-24(21)30-17-25(30)23(28)14-22/h5-10,13,15H,3-4,11-12,14,17,28H2,1-2H3 |
| InChIKey | DAEMHEDRYWZFDR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|