C26H23F6NO — CID 147330985
(1S)-7-phenyl-1-[4-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]heptan-3-one (PubChem CID 147330985) has the molecular formula C26H23F6NO and a molecular weight of 479.46 g/mol. Its IUPAC name is (1S)-7-phenyl-1-[4-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]heptan-3-one.
| Compound Name | (1S)-7-phenyl-1-[4-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]heptan-3-one |
|---|---|
| PubChem CID | 147330985 |
| Molecular Formula | C26H23F6NO |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (1S)-7-phenyl-1-[4-(trifluoromethyl)phenyl]-1-[3-(trifluoromethyl)-2-pyridinyl]heptan-3-one |
| SMILES | O=C(CCCCc1ccccc1)C[C@@H](c1ccc(C(F)(F)F)cc1)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C26H23F6NO/c27-25(28,29)20-14-12-19(13-15-20)22(24-23(26(30,31)32)11-6-16-33-24)17-21(34)10-5-4-9-18-7-2-1-3-8-18/h1-3,6-8,11-16,22H,4-5,9-10,17H2/t22-/m0/s1 |
| InChIKey | DBQRNYMWRADCIU-QFIPXVFZSA-N |
| XLogP | 7.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|