C23H16F6INO — CID 148923666
(4S)-1-(3-iodophenyl)-4-[4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]butan-2-one (PubChem CID 148923666) has the molecular formula C23H16F6INO and a molecular weight of 563.28 g/mol. Its IUPAC name is (4S)-1-(3-iodophenyl)-4-[4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]butan-2-one.
| Compound Name | (4S)-1-(3-iodophenyl)-4-[4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]butan-2-one |
|---|---|
| PubChem CID | 148923666 |
| Molecular Formula | C23H16F6INO |
| Molecular Weight | 563.28 g/mol |
| Exact Mass | 563.02 |
| IUPAC Name | (4S)-1-(3-iodophenyl)-4-[4-(trifluoromethyl)phenyl]-4-[3-(trifluoromethyl)-2-pyridinyl]butan-2-one |
| SMILES | O=C(Cc1cccc(I)c1)C[C@@H](c1ccc(C(F)(F)F)cc1)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C23H16F6INO/c24-22(25,26)16-8-6-15(7-9-16)19(21-20(23(27,28)29)5-2-10-31-21)13-18(32)12-14-3-1-4-17(30)11-14/h1-11,19H,12-13H2/t19-/m0/s1 |
| InChIKey | PKOOPKUBHHECAN-IBGZPJMESA-N |
| XLogP | 7.06 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.28 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|