C22H17BrF3NO — CID 147219151
(4S)-4-(2-bromophenyl)-1-pyridin-3-yl-4-[4-(trifluoromethyl)phenyl]butan-2-one (PubChem CID 147219151) has the molecular formula C22H17BrF3NO and a molecular weight of 448.28 g/mol. Its IUPAC name is (4S)-4-(2-bromophenyl)-1-pyridin-3-yl-4-[4-(trifluoromethyl)phenyl]butan-2-one.
| Compound Name | (4S)-4-(2-bromophenyl)-1-pyridin-3-yl-4-[4-(trifluoromethyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 147219151 |
| Molecular Formula | C22H17BrF3NO |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | (4S)-4-(2-bromophenyl)-1-pyridin-3-yl-4-[4-(trifluoromethyl)phenyl]butan-2-one |
| SMILES | O=C(Cc1cccnc1)C[C@@H](c1ccc(C(F)(F)F)cc1)c1ccccc1Br |
| InChI | InChI=1S/C22H17BrF3NO/c23-21-6-2-1-5-19(21)20(13-18(28)12-15-4-3-11-27-14-15)16-7-9-17(10-8-16)22(24,25)26/h1-11,14,20H,12-13H2/t20-/m0/s1 |
| InChIKey | CGSLIEGNSHPXDE-FQEVSTJZSA-N |
| XLogP | 6.20 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |