C17H22O5 — CID 14733726
[(1R,2E,6E)-3,7-dimethyl-1-[(3R)-4-methylidene-5-oxooxolan-3-yl]-8-oxoocta-2,6-dienyl] acetate (PubChem CID 14733726) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is [(1R,2E,6E)-3,7-dimethyl-1-[(3R)-4-methylidene-5-oxooxolan-3-yl]-8-oxoocta-2,6-dienyl] acetate.
| Compound Name | [(1R,2E,6E)-3,7-dimethyl-1-[(3R)-4-methylidene-5-oxooxolan-3-yl]-8-oxoocta-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 14733726 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [(1R,2E,6E)-3,7-dimethyl-1-[(3R)-4-methylidene-5-oxooxolan-3-yl]-8-oxoocta-2,6-dienyl] acetate |
| SMILES | C=C1C(=O)OC[C@@H]1[C@@H](/C=C(\C)CC/C=C(\C)C=O)OC(C)=O |
| InChI | InChI=1S/C17H22O5/c1-11(6-5-7-12(2)9-18)8-16(22-14(4)19)15-10-21-17(20)13(15)3/h7-9,15-16H,3,5-6,10H2,1-2,4H3/b11-8+,12-7+/t15-,16+/m0/s1 |
| InChIKey | QTCMTKDJKLLGFD-YIIQIHFSSA-N |
| XLogP | 2.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|