About [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium
[4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium (PubChem CID 147338536) has the molecular formula C15H10N3O3Re2-
and a molecular weight of 652.68 g/mol. Its IUPAC name is [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium.
Molecular Properties
| Compound Name | [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium |
| PubChem CID | 147338536 |
| Molecular Formula | C15H10N3O3Re2- |
| Molecular Weight | 652.68 g/mol |
| Exact Mass | 653.98 |
| IUPAC Name | [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium |
| SMILES | [NH-]C(=O)Oc1ccc(-c2n[nH]c(=O)c3ccccc23)cc1.[Re].[Re] |
| InChI | InChI=1S/C15H11N3O3.2Re/c16-15(20)21-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)14(19)18-17-13;;/h1-8H,(H3,16,18,19,20);;/p-1 |
| InChIKey | WSUMZVHVDIOGDJ-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 652.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium?
The IUPAC name of [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium (CID 147338536) is [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium.
What is the SMILES notation for [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium?
The canonical SMILES for [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium is [NH-]C(=O)Oc1ccc(-c2n[nH]c(=O)c3ccccc23)cc1.[Re].[Re].
What is the InChIKey of [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium?
The InChIKey is WSUMZVHVDIOGDJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H11N3O3.2Re/c16-15(20)21-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)14(19)18-17-13;;/h1-8H,(H3,16,18,19,20);;/p-1.
What are the key properties of [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium?
[4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium has a molecular weight of 652.68 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-oxo-3H-phthalazin-1-yl)phenoxy]carbonylazanide;rhenium is sourced from PubChem (CID 147338536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).