C18H13N5O2S — CID 118600298
2-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 118600298) has the molecular formula C18H13N5O2S and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 118600298 |
| Molecular Formula | C18H13N5O2S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(-c2n[nH]c(=O)c3ccccc23)cc1)Nc1nncs1 |
| InChI | InChI=1S/C18H13N5O2S/c24-15(20-18-23-19-10-26-18)9-11-5-7-12(8-6-11)16-13-3-1-2-4-14(13)17(25)22-21-16/h1-8,10H,9H2,(H,22,25)(H,20,23,24) |
| InChIKey | QECZQGDYDZLZFS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |