C16H14N3O3S- — CID 166523602
4-[4-[[methyl(sulfinato)amino]methyl]phenyl]-1-oxo-2H-phthalazine (PubChem CID 166523602) has the molecular formula C16H14N3O3S- and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-[4-[[methyl(sulfinato)amino]methyl]phenyl]-1-oxo-2H-phthalazine.
| Compound Name | 4-[4-[[methyl(sulfinato)amino]methyl]phenyl]-1-oxo-2H-phthalazine |
|---|---|
| PubChem CID | 166523602 |
| Molecular Formula | C16H14N3O3S- |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 4-[4-[[methyl(sulfinato)amino]methyl]phenyl]-1-oxo-2H-phthalazine |
| SMILES | CN(Cc1ccc(-c2n[nH]c(=O)c3ccccc23)cc1)S(=O)[O-] |
| InChI | InChI=1S/C16H15N3O3S/c1-19(23(21)22)10-11-6-8-12(9-7-11)15-13-4-2-3-5-14(13)16(20)18-17-15/h2-9H,10H2,1H3,(H,18,20)(H,21,22)/p-1 |
| InChIKey | AGSGGJACRIFSJO-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|