C24H33N3O — CID 90706844
4-[4-(azepan-1-yl)phenyl]-2H-phthalazin-1-one;ethane (PubChem CID 90706844) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 4-[4-(azepan-1-yl)phenyl]-2H-phthalazin-1-one;ethane.
| Compound Name | 4-[4-(azepan-1-yl)phenyl]-2H-phthalazin-1-one;ethane |
|---|---|
| PubChem CID | 90706844 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 4-[4-(azepan-1-yl)phenyl]-2H-phthalazin-1-one;ethane |
| SMILES | CC.CC.O=c1[nH]nc(-c2ccc(N3CCCCCC3)cc2)c2ccccc12 |
| InChI | InChI=1S/C20H21N3O.2C2H6/c24-20-18-8-4-3-7-17(18)19(21-22-20)15-9-11-16(12-10-15)23-13-5-1-2-6-14-23;2*1-2/h3-4,7-12H,1-2,5-6,13-14H2,(H,22,24);2*1-2H3 |
| InChIKey | BBBJARIQUWKQOI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |