About dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate
dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate (PubChem CID 168648354) has the molecular formula C30H30N4O5
and a molecular weight of 526.59 g/mol. Its IUPAC name is dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate |
| PubChem CID | 168648354 |
| Molecular Formula | C30H30N4O5 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(-c3n[nH]c(=O)c4ccccc34)ccc2N2CCCCCC2)C=CC=C1 |
| InChI | InChI=1S/C30H30N4O5/c1-38-29(36)23-13-7-10-18-34(27(23)30(37)39-2)25-19-20(14-15-24(25)33-16-8-3-4-9-17-33)26-21-11-5-6-12-22(21)28(35)32-31-26/h5-7,10-15,18-19H,3-4,8-9,16-17H2,1-2H3,(H,32,35) |
| InChIKey | PYNXDMGWCYNGNY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate?
The IUPAC name of dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate (CID 168648354) is dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate?
The canonical SMILES for dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate is COC(=O)C1=C(C(=O)OC)N(c2cc(-c3n[nH]c(=O)c4ccccc34)ccc2N2CCCCCC2)C=CC=C1.
What is the InChIKey of dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate?
The InChIKey is PYNXDMGWCYNGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30N4O5/c1-38-29(36)23-13-7-10-18-34(27(23)30(37)39-2)25-19-20(14-15-24(25)33-16-8-3-4-9-17-33)26-21-11-5-6-12-22(21)28(35)32-31-26/h5-7,10-15,18-19H,3-4,8-9,16-17H2,1-2H3,(H,32,35).
What are the key properties of dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate?
dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate has a molecular weight of 526.59 g/mol, XLogP of 4.46, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-[2-(azepan-1-yl)-5-(4-oxo-3H-phthalazin-1-yl)phenyl]azepine-2,3-dicarboxylate is sourced from PubChem (CID 168648354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).