C16H15ClN3O3S- — CID 166523645
1-oxo-4-[4-[(1R)-1-(sulfinatoamino)ethyl]phenyl]-2H-phthalazine;hydrochloride (PubChem CID 166523645) has the molecular formula C16H15ClN3O3S- and a molecular weight of 364.83 g/mol. Its IUPAC name is 1-oxo-4-[4-[(1R)-1-(sulfinatoamino)ethyl]phenyl]-2H-phthalazine;hydrochloride.
| Compound Name | 1-oxo-4-[4-[(1R)-1-(sulfinatoamino)ethyl]phenyl]-2H-phthalazine;hydrochloride |
|---|---|
| PubChem CID | 166523645 |
| Molecular Formula | C16H15ClN3O3S- |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 1-oxo-4-[4-[(1R)-1-(sulfinatoamino)ethyl]phenyl]-2H-phthalazine;hydrochloride |
| SMILES | C[C@@H](NS(=O)[O-])c1ccc(-c2n[nH]c(=O)c3ccccc23)cc1.Cl |
| InChI | InChI=1S/C16H15N3O3S.ClH/c1-10(19-23(21)22)11-6-8-12(9-7-11)15-13-4-2-3-5-14(13)16(20)18-17-15;/h2-10,19H,1H3,(H,18,20)(H,21,22);1H/p-1/t10-;/m1./s1 |
| InChIKey | IRTZGXBPGJLBIE-HNCPQSOCSA-M |
| XLogP | 2.46 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|