C22H31F2N — CID 147338785
N-[2,3-difluoro-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]phenyl]methanimine (PubChem CID 147338785) has the molecular formula C22H31F2N and a molecular weight of 347.49 g/mol. Its IUPAC name is N-[2,3-difluoro-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]phenyl]methanimine.
| Compound Name | N-[2,3-difluoro-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]phenyl]methanimine |
|---|---|
| PubChem CID | 147338785 |
| Molecular Formula | C22H31F2N |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | N-[2,3-difluoro-4-[2-[4-(4-methylcyclohexyl)cyclohexyl]ethyl]phenyl]methanimine |
| SMILES | C=Nc1ccc(CCC2CCC(C3CCC(C)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C22H31F2N/c1-15-3-8-17(9-4-15)18-10-5-16(6-11-18)7-12-19-13-14-20(25-2)22(24)21(19)23/h13-18H,2-12H2,1H3 |
| InChIKey | DDBNMNRPDKWXOQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|